C16H21FN4O — CID 138384460
5-[[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]methyl]-1-methylpiperidin-2-one (PubChem CID 138384460) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-[[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]methyl]-1-methylpiperidin-2-one.
| Compound Name | 5-[[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]methyl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 138384460 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 5-[[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]methyl]-1-methylpiperidin-2-one |
| SMILES | CN(Cc1nc2ccc(F)cc2[nH]1)CC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C16H21FN4O/c1-20(8-11-3-6-16(22)21(2)9-11)10-15-18-13-5-4-12(17)7-14(13)19-15/h4-5,7,11H,3,6,8-10H2,1-2H3,(H,18,19) |
| InChIKey | FHPODCPLLBBYCX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |