C18H24N4O — CID 138387699
1-methyl-5-[[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]methyl]piperidin-2-one (PubChem CID 138387699) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-methyl-5-[[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]methyl]piperidin-2-one.
| Compound Name | 1-methyl-5-[[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 138387699 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-methyl-5-[[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]methyl]piperidin-2-one |
| SMILES | CN(Cc1ccc(-n2cccn2)cc1)CC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C18H24N4O/c1-20(13-16-6-9-18(23)21(2)14-16)12-15-4-7-17(8-5-15)22-11-3-10-19-22/h3-5,7-8,10-11,16H,6,9,12-14H2,1-2H3 |
| InChIKey | AXMPFBBRNIMQBZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |