C17H24ClN5O — CID 119915111
2-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]-1-piperazin-1-ylethanone;hydrochloride (PubChem CID 119915111) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 2-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]-1-piperazin-1-ylethanone;hydrochloride.
| Compound Name | 2-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]-1-piperazin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119915111 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]-1-piperazin-1-ylethanone;hydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)Cc1ccc(-n2cccn2)cc1.Cl |
| InChI | InChI=1S/C17H23N5O.ClH/c1-20(14-17(23)21-11-8-18-9-12-21)13-15-3-5-16(6-4-15)22-10-2-7-19-22;/h2-7,10,18H,8-9,11-14H2,1H3;1H |
| InChIKey | NCKQULSZRZJIQD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |