C15H24ClN3O2 — CID 119929401
2-[(4-methoxyphenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride (PubChem CID 119929401) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride.
| Compound Name | 2-[(4-methoxyphenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119929401 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride |
| SMILES | COc1ccc(CN(C)CC(=O)N2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C15H23N3O2.ClH/c1-17(11-13-3-5-14(20-2)6-4-13)12-15(19)18-9-7-16-8-10-18;/h3-6,16H,7-12H2,1-2H3;1H |
| InChIKey | SZVZRSOSJYTGNU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |