C17H25N3O3 — CID 51171015
1-[2-[(4-methoxyphenyl)methyl-methylamino]acetyl]piperidine-4-carboxamide (PubChem CID 51171015) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-[2-[(4-methoxyphenyl)methyl-methylamino]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[(4-methoxyphenyl)methyl-methylamino]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51171015 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[2-[(4-methoxyphenyl)methyl-methylamino]acetyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN(C)CC(=O)N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-19(11-13-3-5-15(23-2)6-4-13)12-16(21)20-9-7-14(8-10-20)17(18)22/h3-6,14H,7-12H2,1-2H3,(H2,18,22) |
| InChIKey | VGVDQLDJFKCXBI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |