C19H25FN4O3 — CID 154920204
5-[[[1-(4-fluorophenyl)pyrazol-4-yl]methyl-methylamino]methyl]-1-methylpiperidin-2-one;formic acid (PubChem CID 154920204) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is 5-[[[1-(4-fluorophenyl)pyrazol-4-yl]methyl-methylamino]methyl]-1-methylpiperidin-2-one;formic acid.
| Compound Name | 5-[[[1-(4-fluorophenyl)pyrazol-4-yl]methyl-methylamino]methyl]-1-methylpiperidin-2-one;formic acid |
|---|---|
| PubChem CID | 154920204 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-[[[1-(4-fluorophenyl)pyrazol-4-yl]methyl-methylamino]methyl]-1-methylpiperidin-2-one;formic acid |
| SMILES | CN(Cc1cnn(-c2ccc(F)cc2)c1)CC1CCC(=O)N(C)C1.O=CO |
| InChI | InChI=1S/C18H23FN4O.CH2O2/c1-21(10-14-3-8-18(24)22(2)12-14)11-15-9-20-23(13-15)17-6-4-16(19)5-7-17;2-1-3/h4-7,9,13-14H,3,8,10-12H2,1-2H3;1H,(H,2,3) |
| InChIKey | OKYKPZXTCXPXJK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|