C20H28FN5O4 — CID 154908511
1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-3-[(4-methyl-1,4-oxazepan-6-yl)methyl]urea;formic acid (PubChem CID 154908511) has the molecular formula C20H28FN5O4 and a molecular weight of 421.47 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-3-[(4-methyl-1,4-oxazepan-6-yl)methyl]urea;formic acid.
| Compound Name | 1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-3-[(4-methyl-1,4-oxazepan-6-yl)methyl]urea;formic acid |
|---|---|
| PubChem CID | 154908511 |
| Molecular Formula | C20H28FN5O4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-3-[(4-methyl-1,4-oxazepan-6-yl)methyl]urea;formic acid |
| SMILES | CN1CCOCC(CNC(=O)N(C)Cc2cnn(-c3ccc(F)cc3)c2)C1.O=CO |
| InChI | InChI=1S/C19H26FN5O2.CH2O2/c1-23-7-8-27-14-16(11-23)9-21-19(26)24(2)12-15-10-22-25(13-15)18-5-3-17(20)4-6-18;2-1-3/h3-6,10,13,16H,7-9,11-12,14H2,1-2H3,(H,21,26);1H,(H,2,3) |
| InChIKey | OVVRPYBKRITELU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|