C17H19FN4O2S — CID 131926246
N-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylsulfamoyl]-N-methyl-1-phenylmethanamine (PubChem CID 131926246) has the molecular formula C17H19FN4O2S and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylsulfamoyl]-N-methyl-1-phenylmethanamine.
| Compound Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylsulfamoyl]-N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 131926246 |
| Molecular Formula | C17H19FN4O2S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylsulfamoyl]-N-methyl-1-phenylmethanamine |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)N(C)Cc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C17H19FN4O2S/c1-21(11-13-6-4-3-5-7-13)25(23,24)22(2)12-17-19-15-9-8-14(18)10-16(15)20-17/h3-10H,11-12H2,1-2H3,(H,19,20) |
| InChIKey | AKYPIXTWVKISSX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |