C19H19N3O6S5 — CID 22942743
2-[2-[2-[(5-sulfo-1H-indol-2-yl)sulfanyl]ethylsulfanyl]ethylsulfanyl]-3H-benzimidazole-5-sulfonic acid (PubChem CID 22942743) has the molecular formula C19H19N3O6S5 and a molecular weight of 545.71 g/mol. Its IUPAC name is 2-[2-[2-[(5-sulfo-1H-indol-2-yl)sulfanyl]ethylsulfanyl]ethylsulfanyl]-3H-benzimidazole-5-sulfonic acid.
| Compound Name | 2-[2-[2-[(5-sulfo-1H-indol-2-yl)sulfanyl]ethylsulfanyl]ethylsulfanyl]-3H-benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 22942743 |
| Molecular Formula | C19H19N3O6S5 |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | 2-[2-[2-[(5-sulfo-1H-indol-2-yl)sulfanyl]ethylsulfanyl]ethylsulfanyl]-3H-benzimidazole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2[nH]c(SCCSCCSc3nc4ccc(S(=O)(=O)O)cc4[nH]3)cc2c1 |
| InChI | InChI=1S/C19H19N3O6S5/c23-32(24,25)13-1-3-15-12(9-13)10-18(20-15)30-7-5-29-6-8-31-19-21-16-4-2-14(33(26,27)28)11-17(16)22-19/h1-4,9-11,20H,5-8H2,(H,21,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | SNUNQPOAZPJTAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 153.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|