C26H17F2N3O4S — CID 173216785
(3-fluorophenyl) 3-[[2-(3-fluorophenyl)benzoyl]amino]-1H-indazole-5-sulfonate (PubChem CID 173216785) has the molecular formula C26H17F2N3O4S and a molecular weight of 505.50 g/mol. Its IUPAC name is (3-fluorophenyl) 3-[[2-(3-fluorophenyl)benzoyl]amino]-1H-indazole-5-sulfonate.
| Compound Name | (3-fluorophenyl) 3-[[2-(3-fluorophenyl)benzoyl]amino]-1H-indazole-5-sulfonate |
|---|---|
| PubChem CID | 173216785 |
| Molecular Formula | C26H17F2N3O4S |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (3-fluorophenyl) 3-[[2-(3-fluorophenyl)benzoyl]amino]-1H-indazole-5-sulfonate |
| SMILES | O=C(Nc1n[nH]c2ccc(S(=O)(=O)Oc3cccc(F)c3)cc12)c1ccccc1-c1cccc(F)c1 |
| InChI | InChI=1S/C26H17F2N3O4S/c27-17-6-3-5-16(13-17)21-9-1-2-10-22(21)26(32)29-25-23-15-20(11-12-24(23)30-31-25)36(33,34)35-19-8-4-7-18(28)14-19/h1-15H,(H2,29,30,31,32) |
| InChIKey | VTJLAEJBXKBYSV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|