C22H23N3O6S — CID 139697771
2-[4-[[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]sulfamoyl]phenoxy]acetic acid (PubChem CID 139697771) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[4-[[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]sulfamoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]sulfamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 139697771 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-[4-[[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]sulfamoyl]phenoxy]acetic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(OCC(=O)O)cc2)cc(OCCNc2ccncc2)c1 |
| InChI | InChI=1S/C22H23N3O6S/c1-16-12-18(14-20(13-16)30-11-10-24-17-6-8-23-9-7-17)25-32(28,29)21-4-2-19(3-5-21)31-15-22(26)27/h2-9,12-14,25H,10-11,15H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | ULDBIEGAWMIERP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|