C25H29N3O5S — CID 23206264
5-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]pentanoic acid (PubChem CID 23206264) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is 5-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]pentanoic acid.
| Compound Name | 5-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]pentanoic acid |
|---|---|
| PubChem CID | 23206264 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 5-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]pentanoic acid |
| SMILES | Cc1cc(OCCNc2ccncc2)cc(N(CCCCC(=O)O)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H29N3O5S/c1-20-17-22(19-23(18-20)33-16-14-27-21-10-12-26-13-11-21)28(15-6-5-9-25(29)30)34(31,32)24-7-3-2-4-8-24/h2-4,7-8,10-13,17-19H,5-6,9,14-16H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | HJXWNRWYMKZIFC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|