C22H23N3O5S — CID 67620524
2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]acetic acid (PubChem CID 67620524) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]acetic acid.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]acetic acid |
|---|---|
| PubChem CID | 67620524 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]acetic acid |
| SMILES | Cc1cc(OCCNc2ccncc2)cc(N(CC(=O)O)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H23N3O5S/c1-17-13-19(15-20(14-17)30-12-11-24-18-7-9-23-10-8-18)25(16-22(26)27)31(28,29)21-5-3-2-4-6-21/h2-10,13-15H,11-12,16H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | BOMGADHCHYIAKO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|