C23H26N4O4S — CID 23206265
2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]-N-methylacetamide (PubChem CID 23206265) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]-N-methylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]-N-methylacetamide |
|---|---|
| PubChem CID | 23206265 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]anilino]-N-methylacetamide |
| SMILES | CNC(=O)CN(c1cc(C)cc(OCCNc2ccncc2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O4S/c1-18-14-20(16-21(15-18)31-13-12-26-19-8-10-25-11-9-19)27(17-23(28)24-2)32(29,30)22-6-4-3-5-7-22/h3-11,14-16H,12-13,17H2,1-2H3,(H,24,28)(H,25,26) |
| InChIKey | KLZHCCKFUXLINY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|