C17H18FN5O3S — CID 41246455
N-[2-[6-(4-fluorophenyl)pyridazin-3-yl]oxyethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 41246455) has the molecular formula C17H18FN5O3S and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[2-[6-(4-fluorophenyl)pyridazin-3-yl]oxyethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-[6-(4-fluorophenyl)pyridazin-3-yl]oxyethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 41246455 |
| Molecular Formula | C17H18FN5O3S |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[2-[6-(4-fluorophenyl)pyridazin-3-yl]oxyethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCOc1ccc(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C17H18FN5O3S/c1-11-17(12(2)21-20-11)27(24,25)19-9-10-26-16-8-7-15(22-23-16)13-3-5-14(18)6-4-13/h3-8,19H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | HPGXDJJSPQMMOO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|