C12H18FNO6S — CID 61234361
2-fluoro-N,N-bis(2-hydroxyethyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 61234361) has the molecular formula C12H18FNO6S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-fluoro-N,N-bis(2-hydroxyethyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-fluoro-N,N-bis(2-hydroxyethyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 61234361 |
| Molecular Formula | C12H18FNO6S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-fluoro-N,N-bis(2-hydroxyethyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)N(CCO)CCO)cc1OC |
| InChI | InChI=1S/C12H18FNO6S/c1-19-10-7-9(13)12(8-11(10)20-2)21(17,18)14(3-5-15)4-6-16/h7-8,15-16H,3-6H2,1-2H3 |
| InChIKey | WFSVFQXLRXBVKL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |