C10H13FN2O5S — CID 69223080
2-amino-2-(2-fluoro-4,5-dimethoxyphenyl)sulfonylacetamide (PubChem CID 69223080) has the molecular formula C10H13FN2O5S and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-amino-2-(2-fluoro-4,5-dimethoxyphenyl)sulfonylacetamide.
| Compound Name | 2-amino-2-(2-fluoro-4,5-dimethoxyphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 69223080 |
| Molecular Formula | C10H13FN2O5S |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-amino-2-(2-fluoro-4,5-dimethoxyphenyl)sulfonylacetamide |
| SMILES | COc1cc(F)c(S(=O)(=O)C(N)C(N)=O)cc1OC |
| InChI | InChI=1S/C10H13FN2O5S/c1-17-6-3-5(11)8(4-7(6)18-2)19(15,16)10(13)9(12)14/h3-4,10H,13H2,1-2H3,(H2,12,14) |
| InChIKey | SFHFPIKDOWLJBP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |