C13H20FNO4S — CID 35292091
2-fluoro-4,5-dimethoxy-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 35292091) has the molecular formula C13H20FNO4S and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35292091 |
| Molecular Formula | C13H20FNO4S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)NCCC(C)C)cc1OC |
| InChI | InChI=1S/C13H20FNO4S/c1-9(2)5-6-15-20(16,17)13-8-12(19-4)11(18-3)7-10(13)14/h7-9,15H,5-6H2,1-4H3 |
| InChIKey | WYBWEHLHQBRYFN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |