C14H15FN2O4S — CID 167935434
2-fluoro-4,5-dimethoxy-N-methyl-N-pyridin-4-ylbenzenesulfonamide (PubChem CID 167935434) has the molecular formula C14H15FN2O4S and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-methyl-N-pyridin-4-ylbenzenesulfonamide.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-methyl-N-pyridin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 167935434 |
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-methyl-N-pyridin-4-ylbenzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)N(C)c2ccncc2)cc1OC |
| InChI | InChI=1S/C14H15FN2O4S/c1-17(10-4-6-16-7-5-10)22(18,19)14-9-13(21-3)12(20-2)8-11(14)15/h4-9H,1-3H3 |
| InChIKey | QLABYKUZZVTACB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |