C19H25NO7S2 — CID 4785615
N-(4-ethoxyphenyl)sulfonyl-2,5-dimethoxy-N-propylbenzenesulfonamide (PubChem CID 4785615) has the molecular formula C19H25NO7S2 and a molecular weight of 443.54 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)sulfonyl-2,5-dimethoxy-N-propylbenzenesulfonamide.
| Compound Name | N-(4-ethoxyphenyl)sulfonyl-2,5-dimethoxy-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 4785615 |
| Molecular Formula | C19H25NO7S2 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-(4-ethoxyphenyl)sulfonyl-2,5-dimethoxy-N-propylbenzenesulfonamide |
| SMILES | CCCN(S(=O)(=O)c1ccc(OCC)cc1)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H25NO7S2/c1-5-13-20(28(21,22)17-10-7-15(8-11-17)27-6-2)29(23,24)19-14-16(25-3)9-12-18(19)26-4/h7-12,14H,5-6,13H2,1-4H3 |
| InChIKey | SFDNUICKQOYHQT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |