C18H23NO5S — CID 55681499
2,5-dimethoxy-N-methyl-N-(3-phenoxypropyl)benzenesulfonamide (PubChem CID 55681499) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is 2,5-dimethoxy-N-methyl-N-(3-phenoxypropyl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-methyl-N-(3-phenoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55681499 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2,5-dimethoxy-N-methyl-N-(3-phenoxypropyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C)CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C18H23NO5S/c1-19(12-7-13-24-15-8-5-4-6-9-15)25(20,21)18-14-16(22-2)10-11-17(18)23-3/h4-6,8-11,14H,7,12-13H2,1-3H3 |
| InChIKey | SYIISWRNCWQHOP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|