C18H21IN2O4S — CID 45372312
2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-(4-iodophenyl)acetamide (PubChem CID 45372312) has the molecular formula C18H21IN2O4S and a molecular weight of 488.35 g/mol. Its IUPAC name is 2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 45372312 |
| Molecular Formula | C18H21IN2O4S |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-(4-iodophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(I)cc1)S(=O)(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C18H21IN2O4S/c1-4-21(12-18(22)20-15-8-6-14(19)7-9-15)26(23,24)17-11-13(2)5-10-16(17)25-3/h5-11H,4,12H2,1-3H3,(H,20,22) |
| InChIKey | JFEGOEZAFBSFLA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|