C16H16N6O8S — CID 173237002
[carbamimidoyl-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]amino] 4-methylbenzenesulfonate (PubChem CID 173237002) has the molecular formula C16H16N6O8S and a molecular weight of 452.41 g/mol. Its IUPAC name is [carbamimidoyl-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]amino] 4-methylbenzenesulfonate.
| Compound Name | [carbamimidoyl-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173237002 |
| Molecular Formula | C16H16N6O8S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [carbamimidoyl-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]amino] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C(\N)N(N=Cc1c([N+](=O)[O-])ccc(OC)c1[N+](=O)[O-])OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H16N6O8S/c1-10-3-5-11(6-4-10)31(27,28)30-20(16(17)18)19-9-12-13(21(23)24)7-8-14(29-2)15(12)22(25)26/h3-9H,1-2H3,(H3,17,18) |
| InChIKey | AHXMQUMKLZLBRD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 204.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|