C22H21N3O5S — CID 87982520
pyridin-2-yl 3-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate (PubChem CID 87982520) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is pyridin-2-yl 3-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate.
| Compound Name | pyridin-2-yl 3-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87982520 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | pyridin-2-yl 3-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate |
| SMILES | COc1cccc(CC(=O)N/N=C/c2cc(S(=O)(=O)Oc3ccccn3)ccc2C)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-16-9-10-20(31(27,28)30-22-8-3-4-11-23-22)14-18(16)15-24-25-21(26)13-17-6-5-7-19(12-17)29-2/h3-12,14-15H,13H2,1-2H3,(H,25,26)/b24-15+ |
| InChIKey | QZPGAVZBDKBKGB-BUVRLJJBSA-N |
| XLogP | 2.86 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|