C24H24N4O2S3 — CID 4686407
N-[[2,5-bis(methylsulfanyl)-4-[[(2-phenylacetyl)hydrazinylidene]methyl]thiophen-3-yl]methylideneamino]-2-phenylacetamide (PubChem CID 4686407) has the molecular formula C24H24N4O2S3 and a molecular weight of 496.68 g/mol. Its IUPAC name is N-[[2,5-bis(methylsulfanyl)-4-[[(2-phenylacetyl)hydrazinylidene]methyl]thiophen-3-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[[2,5-bis(methylsulfanyl)-4-[[(2-phenylacetyl)hydrazinylidene]methyl]thiophen-3-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 4686407 |
| Molecular Formula | C24H24N4O2S3 |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[[2,5-bis(methylsulfanyl)-4-[[(2-phenylacetyl)hydrazinylidene]methyl]thiophen-3-yl]methylideneamino]-2-phenylacetamide |
| SMILES | CSc1sc(SC)c(C=NNC(=O)Cc2ccccc2)c1C=NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O2S3/c1-31-23-19(15-25-27-21(29)13-17-9-5-3-6-10-17)20(24(32-2)33-23)16-26-28-22(30)14-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | LRELMDRSFFEMDS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|