C13H10BrN3O3S — CID 44507406
1-N-[(E)-(4-bromothiophen-2-yl)methylideneamino]-3-N-hydroxybenzene-1,3-dicarboxamide (PubChem CID 44507406) has the molecular formula C13H10BrN3O3S and a molecular weight of 368.21 g/mol. Its IUPAC name is 1-N-[(E)-(4-bromothiophen-2-yl)methylideneamino]-3-N-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(E)-(4-bromothiophen-2-yl)methylideneamino]-3-N-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 44507406 |
| Molecular Formula | C13H10BrN3O3S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 1-N-[(E)-(4-bromothiophen-2-yl)methylideneamino]-3-N-hydroxybenzene-1,3-dicarboxamide |
| SMILES | O=C(NO)c1cccc(C(=O)N/N=C/c2cc(Br)cs2)c1 |
| InChI | InChI=1S/C13H10BrN3O3S/c14-10-5-11(21-7-10)6-15-16-12(18)8-2-1-3-9(4-8)13(19)17-20/h1-7,20H,(H,16,18)(H,17,19)/b15-6+ |
| InChIKey | WUJVUOPRNCKWPE-GIDUJCDVSA-N |
| XLogP | 2.39 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|