C15H15BrN2O2S — CID 9215276
N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-4-propan-2-yloxybenzamide (PubChem CID 9215276) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 9215276 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)N/N=C\c2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C15H15BrN2O2S/c1-10(2)20-13-5-3-11(4-6-13)15(19)18-17-8-14-7-12(16)9-21-14/h3-10H,1-2H3,(H,18,19)/b17-8- |
| InChIKey | PAYZHMBVGIFMSO-IUXPMGMMSA-N |
| XLogP | 4.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|