C14H12BrN3OS — CID 9234450
N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]cyclopropanecarboxamide (PubChem CID 9234450) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 9234450 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]cyclopropanecarboxamide |
| SMILES | O=C(N/N=C\c1csc(-c2cccc(Br)c2)n1)C1CC1 |
| InChI | InChI=1S/C14H12BrN3OS/c15-11-3-1-2-10(6-11)14-17-12(8-20-14)7-16-18-13(19)9-4-5-9/h1-3,6-9H,4-5H2,(H,18,19)/b16-7- |
| InChIKey | BTXKNYMQRHOLQI-APSNUPSMSA-N |
| XLogP | 3.43 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|