C15H10BrN3OS2 — CID 9176526
N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]thiophene-2-carboxamide (PubChem CID 9176526) has the molecular formula C15H10BrN3OS2 and a molecular weight of 392.30 g/mol. Its IUPAC name is N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9176526 |
| Molecular Formula | C15H10BrN3OS2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | N-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1csc(-c2cccc(Br)c2)n1)c1cccs1 |
| InChI | InChI=1S/C15H10BrN3OS2/c16-11-4-1-3-10(7-11)15-18-12(9-22-15)8-17-19-14(20)13-5-2-6-21-13/h1-9H,(H,19,20)/b17-8- |
| InChIKey | RAMYLNGGKMUSPX-IUXPMGMMSA-N |
| XLogP | 4.40 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|