C16H12BrNO5 — CID 7820174
N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-formylphenoxy)acetamide (PubChem CID 7820174) has the molecular formula C16H12BrNO5 and a molecular weight of 378.18 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-formylphenoxy)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 7820174 |
| Molecular Formula | C16H12BrNO5 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-formylphenoxy)acetamide |
| SMILES | O=Cc1cc(Br)ccc1OCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H12BrNO5/c17-11-1-3-13(10(5-11)7-19)21-8-16(20)18-12-2-4-14-15(6-12)23-9-22-14/h1-7H,8-9H2,(H,18,20) |
| InChIKey | WUECDVJYRQIPNG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|