C16H14BrNO3 — CID 975229
2-(4-bromo-2-formylphenoxy)-N-(3-methylphenyl)acetamide (PubChem CID 975229) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-(3-methylphenyl)acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 975229 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Br)cc2C=O)c1 |
| InChI | InChI=1S/C16H14BrNO3/c1-11-3-2-4-14(7-11)18-16(20)10-21-15-6-5-13(17)8-12(15)9-19/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | QYXMPUNFBPAZLD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|