C15H10BrCl2NO3 — CID 17202094
2-(4-bromo-2-formylphenoxy)-N-(3,5-dichlorophenyl)acetamide (PubChem CID 17202094) has the molecular formula C15H10BrCl2NO3 and a molecular weight of 403.06 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17202094 |
| Molecular Formula | C15H10BrCl2NO3 |
| Molecular Weight | 403.06 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-(3,5-dichlorophenyl)acetamide |
| SMILES | O=Cc1cc(Br)ccc1OCC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10BrCl2NO3/c16-10-1-2-14(9(3-10)7-20)22-8-15(21)19-13-5-11(17)4-12(18)6-13/h1-7H,8H2,(H,19,21) |
| InChIKey | FKFLXNLVBBBNKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.06 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|