C20H21BrN2O4 — CID 18284474
2-(4-bromo-2-formylphenoxy)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide (PubChem CID 18284474) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18284474 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide |
| SMILES | O=Cc1cc(Br)ccc1OCC(=O)Nc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H21BrN2O4/c21-17-3-6-19(16(11-17)13-24)27-14-20(25)22-18-4-1-15(2-5-18)12-23-7-9-26-10-8-23/h1-6,11,13H,7-10,12,14H2,(H,22,25) |
| InChIKey | SJHNKFIPPNISJI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|