C33H27BrClN3O6 — CID 126408733
4-[[2-bromo-6-chloro-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126408733) has the molecular formula C33H27BrClN3O6 and a molecular weight of 676.95 g/mol. Its IUPAC name is 4-[[2-bromo-6-chloro-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-chloro-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126408733 |
| Molecular Formula | C33H27BrClN3O6 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 675.08 |
| IUPAC Name | 4-[[2-bromo-6-chloro-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Cl)c(OCc4ccc(C(=O)O)cc4)c(Br)c3)o2)cc1 |
| InChI | InChI=1S/C33H27BrClN3O6/c1-20-3-4-21(2)38(20)25-9-11-26(12-10-25)42-19-27-13-14-30(44-27)32(39)37-36-17-23-15-28(34)31(29(35)16-23)43-18-22-5-7-24(8-6-22)33(40)41/h3-17H,18-19H2,1-2H3,(H,37,39)(H,40,41)/b36-17+ |
| InChIKey | PPXWGVFZRIVYMD-KULFSUQXSA-N |
| XLogP | 7.72 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|