C35H36N4O4 — CID 126410788
N-[(E)-[4-(dimethylamino)-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126410788) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-(dimethylamino)-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410788 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(COc2cc(N(C)C)ccc2/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1 |
| InChI | InChI=1S/C35H36N4O4/c1-24-6-10-27(11-7-24)22-42-34-20-30(38(4)5)13-12-28(34)21-36-37-35(40)33-19-18-32(43-33)23-41-31-16-14-29(15-17-31)39-25(2)8-9-26(39)3/h6-21H,22-23H2,1-5H3,(H,37,40)/b36-21+ |
| InChIKey | WJMNUKWVMYLSBG-QLQYKETESA-N |
| XLogP | 6.98 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|