C21H21BrN4O — CID 3386870
1-[[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3386870) has the molecular formula C21H21BrN4O and a molecular weight of 425.33 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3386870 |
| Molecular Formula | C21H21BrN4O |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 1-[[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1cc(C)n(-c2cccc(Br)c2)c1C |
| InChI | InChI=1S/C21H21BrN4O/c1-14-7-4-5-10-20(14)24-21(27)25-23-13-17-11-15(2)26(16(17)3)19-9-6-8-18(22)12-19/h4-13H,1-3H3,(H2,24,25,27) |
| InChIKey | GUONRZKYLYRWNI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|