C22H22BrN3OS — CID 92851081
N-[(Z)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-phenylsulfanylpropanamide (PubChem CID 92851081) has the molecular formula C22H22BrN3OS and a molecular weight of 456.41 g/mol. Its IUPAC name is N-[(Z)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-phenylsulfanylpropanamide.
| Compound Name | N-[(Z)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 92851081 |
| Molecular Formula | C22H22BrN3OS |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[(Z)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-phenylsulfanylpropanamide |
| SMILES | Cc1cc(/C=N\NC(=O)CCSc2ccccc2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C22H22BrN3OS/c1-16-13-18(17(2)26(16)20-8-6-7-19(23)14-20)15-24-25-22(27)11-12-28-21-9-4-3-5-10-21/h3-10,13-15H,11-12H2,1-2H3,(H,25,27)/b24-15- |
| InChIKey | IQHPNBFHCWRKIF-IWIPYMOSSA-N |
| XLogP | 5.49 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|