C31H32N4O4 — CID 6873346
2-(3-ethoxyphenyl)-N-[(E)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]quinoline-4-carboxamide (PubChem CID 6873346) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-(3-ethoxyphenyl)-N-[(E)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(3-ethoxyphenyl)-N-[(E)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6873346 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-(3-ethoxyphenyl)-N-[(E)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]quinoline-4-carboxamide |
| SMILES | CCOc1cccc(-c2cc(C(=O)N/N=C/c3ccc(OC)c(CN4CCOCC4)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C31H32N4O4/c1-3-39-25-8-6-7-23(18-25)29-19-27(26-9-4-5-10-28(26)33-29)31(36)34-32-20-22-11-12-30(37-2)24(17-22)21-35-13-15-38-16-14-35/h4-12,17-20H,3,13-16,21H2,1-2H3,(H,34,36)/b32-20+ |
| InChIKey | HDAJPHABDIEHDY-UZWMFBFFSA-N |
| XLogP | 4.91 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|