C32H34N4O2S — CID 17285270
N-[(E)-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]-2-(4-propylphenyl)quinoline-4-carboxamide (PubChem CID 17285270) has the molecular formula C32H34N4O2S and a molecular weight of 538.72 g/mol. Its IUPAC name is N-[(E)-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]-2-(4-propylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]-2-(4-propylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17285270 |
| Molecular Formula | C32H34N4O2S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N-[(E)-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]-2-(4-propylphenyl)quinoline-4-carboxamide |
| SMILES | CCCc1ccc(-c2cc(C(=O)N/N=C/c3ccc(OC)c(CN4CCSCC4)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C32H34N4O2S/c1-3-6-23-9-12-25(13-10-23)30-20-28(27-7-4-5-8-29(27)34-30)32(37)35-33-21-24-11-14-31(38-2)26(19-24)22-36-15-17-39-18-16-36/h4-5,7-14,19-21H,3,6,15-18,22H2,1-2H3,(H,35,37)/b33-21+ |
| InChIKey | OSURLYRFSRELBK-QNKGDIEWSA-N |
| XLogP | 6.18 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|