C22H24N4O2S — CID 22306063
1-ethyl-1-[[2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]thiourea (PubChem CID 22306063) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-ethyl-1-[[2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]thiourea.
| Compound Name | 1-ethyl-1-[[2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 22306063 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-ethyl-1-[[2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]thiourea |
| SMILES | CCN(NC(=O)c1cc(-c2cccc(OC(C)C)c2)nc2ccccc12)C(N)=S |
| InChI | InChI=1S/C22H24N4O2S/c1-4-26(22(23)29)25-21(27)18-13-20(24-19-11-6-5-10-17(18)19)15-8-7-9-16(12-15)28-14(2)3/h5-14H,4H2,1-3H3,(H2,23,29)(H,25,27) |
| InChIKey | IIGJLPQQDWPCHO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|