C24H19ClN4O3 — CID 22305850
1-(3-chlorophenyl)-1-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]urea (PubChem CID 22305850) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]urea.
| Compound Name | 1-(3-chlorophenyl)-1-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]urea |
|---|---|
| PubChem CID | 22305850 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-(3-chlorophenyl)-1-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]urea |
| SMILES | COc1cccc(-c2cc(C(=O)NN(C(N)=O)c3cccc(Cl)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C24H19ClN4O3/c1-32-18-9-4-6-15(12-18)22-14-20(19-10-2-3-11-21(19)27-22)23(30)28-29(24(26)31)17-8-5-7-16(25)13-17/h2-14H,1H3,(H2,26,31)(H,28,30) |
| InChIKey | NBFYXNXPYPQVEK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|