C27H25ClN4O2 — CID 22305853
1-[[2-(4-tert-butylphenyl)quinoline-4-carbonyl]amino]-1-(3-chlorophenyl)urea (PubChem CID 22305853) has the molecular formula C27H25ClN4O2 and a molecular weight of 472.98 g/mol. Its IUPAC name is 1-[[2-(4-tert-butylphenyl)quinoline-4-carbonyl]amino]-1-(3-chlorophenyl)urea.
| Compound Name | 1-[[2-(4-tert-butylphenyl)quinoline-4-carbonyl]amino]-1-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 22305853 |
| Molecular Formula | C27H25ClN4O2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-[[2-(4-tert-butylphenyl)quinoline-4-carbonyl]amino]-1-(3-chlorophenyl)urea |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(=O)NN(C(N)=O)c3cccc(Cl)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H25ClN4O2/c1-27(2,3)18-13-11-17(12-14-18)24-16-22(21-9-4-5-10-23(21)30-24)25(33)31-32(26(29)34)20-8-6-7-19(28)15-20/h4-16H,1-3H3,(H2,29,34)(H,31,33) |
| InChIKey | JMQJFWNMTSANBD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|