C23H16BrClN4O2 — CID 22305706
1-[[2-(4-bromophenyl)quinoline-4-carbonyl]amino]-1-(4-chlorophenyl)urea (PubChem CID 22305706) has the molecular formula C23H16BrClN4O2 and a molecular weight of 495.76 g/mol. Its IUPAC name is 1-[[2-(4-bromophenyl)quinoline-4-carbonyl]amino]-1-(4-chlorophenyl)urea.
| Compound Name | 1-[[2-(4-bromophenyl)quinoline-4-carbonyl]amino]-1-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 22305706 |
| Molecular Formula | C23H16BrClN4O2 |
| Molecular Weight | 495.76 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 1-[[2-(4-bromophenyl)quinoline-4-carbonyl]amino]-1-(4-chlorophenyl)urea |
| SMILES | NC(=O)N(NC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16BrClN4O2/c24-15-7-5-14(6-8-15)21-13-19(18-3-1-2-4-20(18)27-21)22(30)28-29(23(26)31)17-11-9-16(25)10-12-17/h1-13H,(H2,26,31)(H,28,30) |
| InChIKey | BJVHYSYJBWKHQR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|