C17H13BrN4O — CID 19955905
2-(4-bromophenyl)-N-(diaminomethylidene)quinoline-4-carboxamide (PubChem CID 19955905) has the molecular formula C17H13BrN4O and a molecular weight of 369.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(diaminomethylidene)quinoline-4-carboxamide.
| Compound Name | 2-(4-bromophenyl)-N-(diaminomethylidene)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19955905 |
| Molecular Formula | C17H13BrN4O |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-(4-bromophenyl)-N-(diaminomethylidene)quinoline-4-carboxamide |
| SMILES | NC(N)=NC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12 |
| InChI | InChI=1S/C17H13BrN4O/c18-11-7-5-10(6-8-11)15-9-13(16(23)22-17(19)20)12-3-1-2-4-14(12)21-15/h1-9H,(H4,19,20,22,23) |
| InChIKey | LDLOBGSTWPGTCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|