C26H23ClN4O2 — CID 22305855
1-(3-chlorophenyl)-1-[[2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]urea (PubChem CID 22305855) has the molecular formula C26H23ClN4O2 and a molecular weight of 458.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-[[2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]urea.
| Compound Name | 1-(3-chlorophenyl)-1-[[2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]urea |
|---|---|
| PubChem CID | 22305855 |
| Molecular Formula | C26H23ClN4O2 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-(3-chlorophenyl)-1-[[2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]urea |
| SMILES | CC(C)c1ccc(-c2cc(C(=O)NN(C(N)=O)c3cccc(Cl)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H23ClN4O2/c1-16(2)17-10-12-18(13-11-17)24-15-22(21-8-3-4-9-23(21)29-24)25(32)30-31(26(28)33)20-7-5-6-19(27)14-20/h3-16H,1-2H3,(H2,28,33)(H,30,32) |
| InChIKey | MNYDHIOGHGEJCZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|