C16H20N4OS — CID 22301211
1-ethyl-1-[(2-propylquinoline-4-carbonyl)amino]thiourea (PubChem CID 22301211) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-ethyl-1-[(2-propylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-ethyl-1-[(2-propylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 22301211 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-ethyl-1-[(2-propylquinoline-4-carbonyl)amino]thiourea |
| SMILES | CCCc1cc(C(=O)NN(CC)C(N)=S)c2ccccc2n1 |
| InChI | InChI=1S/C16H20N4OS/c1-3-7-11-10-13(12-8-5-6-9-14(12)18-11)15(21)19-20(4-2)16(17)22/h5-6,8-10H,3-4,7H2,1-2H3,(H2,17,22)(H,19,21) |
| InChIKey | JRECMIFHELECPP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|