C24H27N3O3 — CID 1226483
N-[(2,4-diethoxyphenyl)methylideneamino]-2-propylquinoline-4-carboxamide (PubChem CID 1226483) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(2,4-diethoxyphenyl)methylideneamino]-2-propylquinoline-4-carboxamide.
| Compound Name | N-[(2,4-diethoxyphenyl)methylideneamino]-2-propylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 1226483 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[(2,4-diethoxyphenyl)methylideneamino]-2-propylquinoline-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NN=Cc2ccc(OCC)cc2OCC)c2ccccc2n1 |
| InChI | InChI=1S/C24H27N3O3/c1-4-9-18-14-21(20-10-7-8-11-22(20)26-18)24(28)27-25-16-17-12-13-19(29-5-2)15-23(17)30-6-3/h7-8,10-16H,4-6,9H2,1-3H3,(H,27,28) |
| InChIKey | BLAVSKJSSAEVAD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|