C20H20N4O3 — CID 19955653
N-(diaminomethylidene)-2-[3-(ethoxymethoxy)phenyl]quinoline-4-carboxamide (PubChem CID 19955653) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-[3-(ethoxymethoxy)phenyl]quinoline-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-2-[3-(ethoxymethoxy)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19955653 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(diaminomethylidene)-2-[3-(ethoxymethoxy)phenyl]quinoline-4-carboxamide |
| SMILES | CCOCOc1cccc(-c2cc(C(=O)N=C(N)N)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-2-26-12-27-14-7-5-6-13(10-14)18-11-16(19(25)24-20(21)22)15-8-3-4-9-17(15)23-18/h3-11H,2,12H2,1H3,(H4,21,22,24,25) |
| InChIKey | MCNPOEMLFPJHBY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|