C25H25N5O4S — CID 77105680
N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide (PubChem CID 77105680) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide.
| Compound Name | N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 77105680 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCOc1ccc(-c2ccc(-c3cc(C(=O)NN)c4cnccc4n3)cc2)cc1 |
| InChI | InChI=1S/C25H25N5O4S/c1-35(32,33)28-12-2-14-34-20-9-7-18(8-10-20)17-3-5-19(6-4-17)24-15-21(25(31)30-26)22-16-27-13-11-23(22)29-24/h3-11,13,15-16,28H,2,12,14,26H2,1H3,(H,30,31) |
| InChIKey | AWJTZLCMVFUYEZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|