C30H25ClN6O5 — CID 118558363
1-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]-1,2-oxazole-5-carbonyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 118558363) has the molecular formula C30H25ClN6O5 and a molecular weight of 585.02 g/mol. Its IUPAC name is 1-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]-1,2-oxazole-5-carbonyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | 1-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]-1,2-oxazole-5-carbonyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 118558363 |
| Molecular Formula | C30H25ClN6O5 |
| Molecular Weight | 585.02 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 1-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]-1,2-oxazole-5-carbonyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.NNC(=O)c1cc(-c2ccc(-c3ccc(-c4cc(C(=O)N5CCCC5C(=O)O)on4)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C30H24N6O5.ClH/c31-34-28(37)21-14-24(33-23-11-12-32-16-22(21)23)19-7-3-17(4-8-19)18-5-9-20(10-6-18)25-15-27(41-35-25)29(38)36-13-1-2-26(36)30(39)40;/h3-12,14-16,26H,1-2,13,31H2,(H,34,37)(H,39,40);1H |
| InChIKey | WYEBGABWUGIQIK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 164.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.02 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|